C28H36N4O3 — CID 58170906
(3R)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide (PubChem CID 58170906) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is (3R)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 58170906 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | (3R)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide |
| SMILES | COCCCn1cc(CN(C(=O)[C@H]2CNCCC2c2ccn(C)c(=O)c2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C28H36N4O3/c1-30-14-11-20(16-27(30)33)23-10-12-29-17-25(23)28(34)32(22-8-9-22)19-21-18-31(13-5-15-35-2)26-7-4-3-6-24(21)26/h3-4,6-7,11,14,16,18,22-23,25,29H,5,8-10,12-13,15,17,19H2,1-2H3/t23?,25-/m0/s1 |
| InChIKey | JZXHVNKYCRZJGN-YNMFNDETSA-N |
| XLogP | 3.26 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|