C30H35N3O2S — CID 11993308
(3R,4S)-4-(1-benzothiophen-3-yl)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide (PubChem CID 11993308) has the molecular formula C30H35N3O2S and a molecular weight of 501.70 g/mol. Its IUPAC name is (3R,4S)-4-(1-benzothiophen-3-yl)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide.
| Compound Name | (3R,4S)-4-(1-benzothiophen-3-yl)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 11993308 |
| Molecular Formula | C30H35N3O2S |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | (3R,4S)-4-(1-benzothiophen-3-yl)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide |
| SMILES | COCCCn1cc(CN(C(=O)[C@H]2CNCC[C@@H]2c2csc3ccccc23)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C30H35N3O2S/c1-35-16-6-15-32-18-21(23-7-2-4-9-28(23)32)19-33(22-11-12-22)30(34)26-17-31-14-13-24(26)27-20-36-29-10-5-3-8-25(27)29/h2-5,7-10,18,20,22,24,26,31H,6,11-17,19H2,1H3/t24-,26-/m0/s1 |
| InChIKey | OEVRYLZDCGWGKJ-AHWVRZQESA-N |
| XLogP | 5.78 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|