C22H32N4O2 — CID 67273331
(3S,5R)-5-amino-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide (PubChem CID 67273331) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is (3S,5R)-5-amino-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide.
| Compound Name | (3S,5R)-5-amino-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 67273331 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (3S,5R)-5-amino-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide |
| SMILES | COCCCn1cc(CN(C(=O)[C@@H]2CNC[C@H](N)C2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C22H32N4O2/c1-28-10-4-9-25-14-17(20-5-2-3-6-21(20)25)15-26(19-7-8-19)22(27)16-11-18(23)13-24-12-16/h2-3,5-6,14,16,18-19,24H,4,7-13,15,23H2,1H3/t16-,18+/m0/s1 |
| InChIKey | FGLIGOIFUHFBIN-FUHWJXTLSA-N |
| XLogP | 2.11 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|