C27H40N4O3 — CID 118709235
(3R,5S)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-5-(3-methylbutanoylamino)piperidine-3-carboxamide (PubChem CID 118709235) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is (3R,5S)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-5-(3-methylbutanoylamino)piperidine-3-carboxamide.
| Compound Name | (3R,5S)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-5-(3-methylbutanoylamino)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 118709235 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | (3R,5S)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-5-(3-methylbutanoylamino)piperidine-3-carboxamide |
| SMILES | COCCCn1cc(CN(C(=O)[C@H]2CNC[C@@H](NC(=O)CC(C)C)C2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C27H40N4O3/c1-19(2)13-26(32)29-22-14-20(15-28-16-22)27(33)31(23-9-10-23)18-21-17-30(11-6-12-34-3)25-8-5-4-7-24(21)25/h4-5,7-8,17,19-20,22-23,28H,6,9-16,18H2,1-3H3,(H,29,32)/t20-,22+/m1/s1 |
| InChIKey | NPNSFUVCVVSOOL-IRLDBZIGSA-N |
| XLogP | 3.31 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|