C27H40N4O3 — CID 90912421
(3S,5S)-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]-5-(3-methylbutanoylamino)piperidine-3-carboxamide (PubChem CID 90912421) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is (3S,5S)-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]-5-(3-methylbutanoylamino)piperidine-3-carboxamide.
| Compound Name | (3S,5S)-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]-5-(3-methylbutanoylamino)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90912421 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | (3S,5S)-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]-5-(3-methylbutanoylamino)piperidine-3-carboxamide |
| SMILES | COCCCC(c1c[nH]c2ccccc12)N(C(=O)[C@@H]1CNC[C@@H](NC(=O)CC(C)C)C1)C1CC1 |
| InChI | InChI=1S/C27H40N4O3/c1-18(2)13-26(32)30-20-14-19(15-28-16-20)27(33)31(21-10-11-21)25(9-6-12-34-3)23-17-29-24-8-5-4-7-22(23)24/h4-5,7-8,17-21,25,28-29H,6,9-16H2,1-3H3,(H,30,32)/t19-,20-,25?/m0/s1 |
| InChIKey | WYXRRCFVKLWIJU-QGGGIAGFSA-N |
| XLogP | 3.77 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|