C29H36N4O3 — CID 90742573
(3S,5S)-5-benzamido-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]piperidine-3-carboxamide (PubChem CID 90742573) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is (3S,5S)-5-benzamido-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]piperidine-3-carboxamide.
| Compound Name | (3S,5S)-5-benzamido-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90742573 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | (3S,5S)-5-benzamido-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]piperidine-3-carboxamide |
| SMILES | COCCCC(c1c[nH]c2ccccc12)N(C(=O)[C@@H]1CNC[C@@H](NC(=O)c2ccccc2)C1)C1CC1 |
| InChI | InChI=1S/C29H36N4O3/c1-36-15-7-12-27(25-19-31-26-11-6-5-10-24(25)26)33(23-13-14-23)29(35)21-16-22(18-30-17-21)32-28(34)20-8-3-2-4-9-20/h2-6,8-11,19,21-23,27,30-31H,7,12-18H2,1H3,(H,32,34)/t21-,22-,27?/m0/s1 |
| InChIKey | OJOXICMJBQMAMW-BTOHDXCHSA-N |
| XLogP | 4.03 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|