C32H42N4O3 — CID 90685428
(3S,5S)-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]-5-[(2-methyl-2-phenylpropanoyl)amino]piperidine-3-carboxamide (PubChem CID 90685428) has the molecular formula C32H42N4O3 and a molecular weight of 530.71 g/mol. Its IUPAC name is (3S,5S)-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]-5-[(2-methyl-2-phenylpropanoyl)amino]piperidine-3-carboxamide.
| Compound Name | (3S,5S)-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]-5-[(2-methyl-2-phenylpropanoyl)amino]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90685428 |
| Molecular Formula | C32H42N4O3 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | (3S,5S)-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]-5-[(2-methyl-2-phenylpropanoyl)amino]piperidine-3-carboxamide |
| SMILES | COCCCC(c1c[nH]c2ccccc12)N(C(=O)[C@@H]1CNC[C@@H](NC(=O)C(C)(C)c2ccccc2)C1)C1CC1 |
| InChI | InChI=1S/C32H42N4O3/c1-32(2,23-10-5-4-6-11-23)31(38)35-24-18-22(19-33-20-24)30(37)36(25-15-16-25)29(14-9-17-39-3)27-21-34-28-13-8-7-12-26(27)28/h4-8,10-13,21-22,24-25,29,33-34H,9,14-20H2,1-3H3,(H,35,38)/t22-,24-,29?/m0/s1 |
| InChIKey | WPWFTOAMHMVNNR-ODNKRBPHSA-N |
| XLogP | 4.70 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|