C27H38N4O4 — CID 69065629
(3S,5R)-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]-5-(oxolane-2-carbonylamino)piperidine-3-carboxamide (PubChem CID 69065629) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is (3S,5R)-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]-5-(oxolane-2-carbonylamino)piperidine-3-carboxamide.
| Compound Name | (3S,5R)-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]-5-(oxolane-2-carbonylamino)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 69065629 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | (3S,5R)-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]-5-(oxolane-2-carbonylamino)piperidine-3-carboxamide |
| SMILES | COCCCC(c1c[nH]c2ccccc12)N(C(=O)[C@@H]1CNC[C@H](NC(=O)C2CCCO2)C1)C1CC1 |
| InChI | InChI=1S/C27H38N4O4/c1-34-12-4-8-24(22-17-29-23-7-3-2-6-21(22)23)31(20-10-11-20)27(33)18-14-19(16-28-15-18)30-26(32)25-9-5-13-35-25/h2-3,6-7,17-20,24-25,28-29H,4-5,8-16H2,1H3,(H,30,32)/t18-,19+,24?,25?/m0/s1 |
| InChIKey | JSPCAPNGIGWEBY-KPKAVXFZSA-N |
| XLogP | 2.90 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|