C16H20N2O2 — CID 99826862
(2S)-N-ethyl-N-(1H-indol-3-ylmethyl)oxolane-2-carboxamide (PubChem CID 99826862) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is (2S)-N-ethyl-N-(1H-indol-3-ylmethyl)oxolane-2-carboxamide.
| Compound Name | (2S)-N-ethyl-N-(1H-indol-3-ylmethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 99826862 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (2S)-N-ethyl-N-(1H-indol-3-ylmethyl)oxolane-2-carboxamide |
| SMILES | CCN(Cc1c[nH]c2ccccc12)C(=O)[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H20N2O2/c1-2-18(16(19)15-8-5-9-20-15)11-12-10-17-14-7-4-3-6-13(12)14/h3-4,6-7,10,15,17H,2,5,8-9,11H2,1H3/t15-/m0/s1 |
| InChIKey | SBMGHKQTKRWLEX-HNNXBMFYSA-N |
| XLogP | 2.70 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |