C16H23NO4 — CID 78808324
N-[(3,4-dimethoxyphenyl)methyl]-N-ethyloxolane-2-carboxamide (PubChem CID 78808324) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-ethyloxolane-2-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-ethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 78808324 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-ethyloxolane-2-carboxamide |
| SMILES | CCN(Cc1ccc(OC)c(OC)c1)C(=O)C1CCCO1 |
| InChI | InChI=1S/C16H23NO4/c1-4-17(16(18)14-6-5-9-21-14)11-12-7-8-13(19-2)15(10-12)20-3/h7-8,10,14H,4-6,9,11H2,1-3H3 |
| InChIKey | WPNZAIABKOQPFR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |