C15H19F2NO4 — CID 94182088
(2S)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methyloxolane-2-carboxamide (PubChem CID 94182088) has the molecular formula C15H19F2NO4 and a molecular weight of 315.32 g/mol. Its IUPAC name is (2S)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methyloxolane-2-carboxamide.
| Compound Name | (2S)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 94182088 |
| Molecular Formula | C15H19F2NO4 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (2S)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-N-methyloxolane-2-carboxamide |
| SMILES | COc1cc(CN(C)C(=O)[C@@H]2CCCO2)ccc1OC(F)F |
| InChI | InChI=1S/C15H19F2NO4/c1-18(14(19)12-4-3-7-21-12)9-10-5-6-11(22-15(16)17)13(8-10)20-2/h5-6,8,12,15H,3-4,7,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | VAOJWXXUQPCBPP-LBPRGKRZSA-N |
| XLogP | 2.43 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |