C20H26N2O3 — CID 47077973
2-[bis(oxolan-2-ylmethyl)amino]-1-(1H-indol-3-yl)ethanone (PubChem CID 47077973) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[bis(oxolan-2-ylmethyl)amino]-1-(1H-indol-3-yl)ethanone.
| Compound Name | 2-[bis(oxolan-2-ylmethyl)amino]-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 47077973 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[bis(oxolan-2-ylmethyl)amino]-1-(1H-indol-3-yl)ethanone |
| SMILES | O=C(CN(CC1CCCO1)CC1CCCO1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H26N2O3/c23-20(18-11-21-19-8-2-1-7-17(18)19)14-22(12-15-5-3-9-24-15)13-16-6-4-10-25-16/h1-2,7-8,11,15-16,21H,3-6,9-10,12-14H2 |
| InChIKey | OIEUBMIDQXUCAZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |