C27H40N4O4 — CID 69074285
tert-butyl N-[(3R,5S)-5-[cyclopropyl-[1-(1H-indol-3-yl)-4-methoxybutyl]carbamoyl]piperidin-3-yl]carbamate (PubChem CID 69074285) has the molecular formula C27H40N4O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is tert-butyl N-[(3R,5S)-5-[cyclopropyl-[1-(1H-indol-3-yl)-4-methoxybutyl]carbamoyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,5S)-5-[cyclopropyl-[1-(1H-indol-3-yl)-4-methoxybutyl]carbamoyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 69074285 |
| Molecular Formula | C27H40N4O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | tert-butyl N-[(3R,5S)-5-[cyclopropyl-[1-(1H-indol-3-yl)-4-methoxybutyl]carbamoyl]piperidin-3-yl]carbamate |
| SMILES | COCCCC(c1c[nH]c2ccccc12)N(C(=O)[C@@H]1CNC[C@H](NC(=O)OC(C)(C)C)C1)C1CC1 |
| InChI | InChI=1S/C27H40N4O4/c1-27(2,3)35-26(33)30-19-14-18(15-28-16-19)25(32)31(20-11-12-20)24(10-7-13-34-4)22-17-29-23-9-6-5-8-21(22)23/h5-6,8-9,17-20,24,28-29H,7,10-16H2,1-4H3,(H,30,33)/t18-,19+,24?/m0/s1 |
| InChIKey | UOZCVZBBBXUSEB-ZJWBFHOUSA-N |
| XLogP | 4.13 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|