C27H40N4O4 — CID 69066986
tert-butyl N-[5-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]piperidin-3-yl]carbamate (PubChem CID 69066986) has the molecular formula C27H40N4O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is tert-butyl N-[5-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 69066986 |
| Molecular Formula | C27H40N4O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | tert-butyl N-[5-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]piperidin-3-yl]carbamate |
| SMILES | COCCCn1cc(CN(C(=O)C2CNCC(NC(=O)OC(C)(C)C)C2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C27H40N4O4/c1-27(2,3)35-26(33)29-21-14-19(15-28-16-21)25(32)31(22-10-11-22)18-20-17-30(12-7-13-34-4)24-9-6-5-8-23(20)24/h5-6,8-9,17,19,21-22,28H,7,10-16,18H2,1-4H3,(H,29,33) |
| InChIKey | SOIRHWSORJMKAT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|