C32H43N5O3 — CID 143390498
(3S,5R)-5-[[[1-(benzylamino)-2-oxoethyl]amino]methyl]-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide (PubChem CID 143390498) has the molecular formula C32H43N5O3 and a molecular weight of 545.73 g/mol. Its IUPAC name is (3S,5R)-5-[[[1-(benzylamino)-2-oxoethyl]amino]methyl]-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide.
| Compound Name | (3S,5R)-5-[[[1-(benzylamino)-2-oxoethyl]amino]methyl]-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 143390498 |
| Molecular Formula | C32H43N5O3 |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | (3S,5R)-5-[[[1-(benzylamino)-2-oxoethyl]amino]methyl]-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide |
| SMILES | COCCCn1cc(CN(C(=O)[C@@H]2CNC[C@H](CNC(C=O)NCc3ccccc3)C2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C32H43N5O3/c1-40-15-7-14-36-21-27(29-10-5-6-11-30(29)36)22-37(28-12-13-28)32(39)26-16-25(17-33-20-26)19-35-31(23-38)34-18-24-8-3-2-4-9-24/h2-6,8-11,21,23,25-26,28,31,33-35H,7,12-20,22H2,1H3/t25-,26+,31?/m1/s1 |
| InChIKey | ZKXHQDQRMHVNSS-FKCWEYQYSA-N |
| XLogP | 3.30 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|