C37H42N4O4 — CID 69064234
9H-fluoren-9-ylmethyl 3-amino-5-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 69064234) has the molecular formula C37H42N4O4 and a molecular weight of 606.77 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-amino-5-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-amino-5-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69064234 |
| Molecular Formula | C37H42N4O4 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-amino-5-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | COCCCn1cc(CN(C(=O)C2CC(N)CN(C(=O)OCC3c4ccccc4-c4ccccc43)C2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C37H42N4O4/c1-44-18-8-17-39-21-26(29-9-6-7-14-35(29)39)22-41(28-15-16-28)36(42)25-19-27(38)23-40(20-25)37(43)45-24-34-32-12-4-2-10-30(32)31-11-3-5-13-33(31)34/h2-7,9-14,21,25,27-28,34H,8,15-20,22-24,38H2,1H3 |
| InChIKey | CPPPGNUCBFHHNL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|