C26H38N4O5 — CID 69065258
2-methoxyethyl N-[5-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]piperidin-3-yl]carbamate (PubChem CID 69065258) has the molecular formula C26H38N4O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is 2-methoxyethyl N-[5-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]piperidin-3-yl]carbamate.
| Compound Name | 2-methoxyethyl N-[5-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 69065258 |
| Molecular Formula | C26H38N4O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 2-methoxyethyl N-[5-[cyclopropyl-[[1-(3-methoxypropyl)indol-3-yl]methyl]carbamoyl]piperidin-3-yl]carbamate |
| SMILES | COCCCn1cc(CN(C(=O)C2CNCC(NC(=O)OCCOC)C2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C26H38N4O5/c1-33-11-5-10-29-17-20(23-6-3-4-7-24(23)29)18-30(22-8-9-22)25(31)19-14-21(16-27-15-19)28-26(32)35-13-12-34-2/h3-4,6-7,17,19,21-22,27H,5,8-16,18H2,1-2H3,(H,28,32) |
| InChIKey | CNHWRANELCYVEL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|