cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride

C7H11ClO2 — CID 14711766

IUPACcis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride
SMILESCO[C@H]1CCC[C@H]1C(=O)Cl
InChIInChI=1S/C7H11ClO2/c1-10-6-4-2-3-5(6)7(8)9/h5-6H,2-4H2,1H3/t5-,6+/m1/s1
InChIKeyDSJHCBIANACFMM-RITPCOANSA-N
MW162.62 g/mol
LogP1.57
Rot. Bonds2

About cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride

cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride (PubChem CID 14711766) has the molecular formula C7H11ClO2 and a molecular weight of 162.62 g/mol. Its IUPAC name is cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride.

Molecular Properties

Compound Namecis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride
PubChem CID14711766
Molecular FormulaC7H11ClO2
Molecular Weight162.62 g/mol
Exact Mass162.04
IUPAC Namecis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride
SMILESCO[C@H]1CCC[C@H]1C(=O)Cl
InChIInChI=1S/C7H11ClO2/c1-10-6-4-2-3-5(6)7(8)9/h5-6H,2-4H2,1H3/t5-,6+/m1/s1
InChIKeyDSJHCBIANACFMM-RITPCOANSA-N
XLogP1.57
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.62
LogP ≤ 51.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

methyl (1S)-2-methoxycyclopentane-1-carboxylate
CID 59162842
trans-(1R,2R)-cyclohexane-1,2-dicarbonyl chloride
CID 12501622
2-methoxycyclobutane-1-carboxylic acid
CID 130021042
cis-(1R,2S)-1,2-dimethoxycyclopentane
CID 21122335
cis-ethyl (1R,2S)-2-methoxycyclohexane-1-carboxylate
CID 57224472
methyl 2-carbonochloridoylcyclobutane-1-carboxylate
CID 12809237
3-methylcyclohexane-1,2-dicarbonyl chloride
CID 142725908
2-[(2-methoxycyclopentyl)carbamoylamino]cyclohexane-1-carboxylic acid
CID 64817335
1-[(1R,2R)-2-methoxycyclopentyl]-3,3-diphenylprop-2-en-1-one
CID 102475755
[(1R)-2-methoxycyclohexyl] acetate
CID 54050527
2,6-dimethoxycyclohexane-1-sulfinic acid
CID 170150058
(1S,2S,6S)-2-chloro-6-methoxycyclohexan-1-ol
CID 130847345

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride?
The IUPAC name of cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride (CID 14711766) is cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride.
What is the SMILES notation for cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride?
The canonical SMILES for cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride is CO[C@H]1CCC[C@H]1C(=O)Cl.
What is the InChIKey of cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride?
The InChIKey is DSJHCBIANACFMM-RITPCOANSA-N. The full InChI is InChI=1S/C7H11ClO2/c1-10-6-4-2-3-5(6)7(8)9/h5-6H,2-4H2,1H3/t5-,6+/m1/s1.
What are the key properties of cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride?
cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride has a molecular weight of 162.62 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-methoxycyclopentane-1-carbonyl chloride is sourced from PubChem (CID 14711766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).