C7H13ClO2 — CID 130847345
(1S,2S,6S)-2-chloro-6-methoxycyclohexan-1-ol (PubChem CID 130847345) has the molecular formula C7H13ClO2 and a molecular weight of 164.63 g/mol. Its IUPAC name is (1S,2S,6S)-2-chloro-6-methoxycyclohexan-1-ol.
| Compound Name | (1S,2S,6S)-2-chloro-6-methoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 130847345 |
| Molecular Formula | C7H13ClO2 |
| Molecular Weight | 164.63 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (1S,2S,6S)-2-chloro-6-methoxycyclohexan-1-ol |
| SMILES | CO[C@H]1CCC[C@H](Cl)[C@H]1O |
| InChI | InChI=1S/C7H13ClO2/c1-10-6-4-2-3-5(8)7(6)9/h5-7,9H,2-4H2,1H3/t5-,6-,7+/m0/s1 |
| InChIKey | PLRHLHBHIFAZAL-LYFYHCNISA-N |
| XLogP | 1.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.63 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|