C12H22O2 — CID 175940017
1,8-dimethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 175940017) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1,8-dimethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 1,8-dimethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 175940017 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 1,8-dimethoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | COC1CCCC2CCCC(OC)C21 |
| InChI | InChI=1S/C12H22O2/c1-13-10-7-3-5-9-6-4-8-11(14-2)12(9)10/h9-12H,3-8H2,1-2H3 |
| InChIKey | SDYPDIJSGAPYAS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |