C16H15F3O2S — CID 14711961
1,1,1-trifluoro-3-(4-methylphenyl)sulfinyl-2-phenylpropan-2-ol (PubChem CID 14711961) has the molecular formula C16H15F3O2S and a molecular weight of 328.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(4-methylphenyl)sulfinyl-2-phenylpropan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-(4-methylphenyl)sulfinyl-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 14711961 |
| Molecular Formula | C16H15F3O2S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1,1,1-trifluoro-3-(4-methylphenyl)sulfinyl-2-phenylpropan-2-ol |
| SMILES | Cc1ccc(S(=O)CC(O)(c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3O2S/c1-12-7-9-14(10-8-12)22(21)11-15(20,16(17,18)19)13-5-3-2-4-6-13/h2-10,20H,11H2,1H3 |
| InChIKey | RFFRLYAXQHUESX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |