C12H21O8- — CID 147119633
[(2R,3S,5R)-5-[(2R,3S,4R,6R)-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-hydroxyoxan-2-yl]methanolate (PubChem CID 147119633) has the molecular formula C12H21O8- and a molecular weight of 293.29 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[(2R,3S,4R,6R)-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-hydroxyoxan-2-yl]methanolate.
| Compound Name | [(2R,3S,5R)-5-[(2R,3S,4R,6R)-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-hydroxyoxan-2-yl]methanolate |
|---|---|
| PubChem CID | 147119633 |
| Molecular Formula | C12H21O8- |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | [(2R,3S,5R)-5-[(2R,3S,4R,6R)-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-hydroxyoxan-2-yl]methanolate |
| SMILES | [O-]C[C@H]1OC[C@H](O[C@H]2O[C@@H](CO)C[C@@H](O)[C@@H]2O)C[C@@H]1O |
| InChI | InChI=1S/C12H21O8/c13-3-6-1-9(16)11(17)12(19-6)20-7-2-8(15)10(4-14)18-5-7/h6-13,15-17H,1-5H2/q-1/t6-,7-,8+,9-,10-,11+,12-/m1/s1 |
| InChIKey | BOCHHDGNDDYDMN-FGJFCTRUSA-N |
| XLogP | -3.29 |
| TPSA | 131.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |