C30H29F3N4O — CID 147121604
3-(2-methyl-4-pyridinyl)-6-[(3S,4R)-4-phenyl-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]-5,8-dihydro-1H-pyrrolo[3,4-g]isoquinolin-7-one (PubChem CID 147121604) has the molecular formula C30H29F3N4O and a molecular weight of 518.58 g/mol. Its IUPAC name is 3-(2-methyl-4-pyridinyl)-6-[(3S,4R)-4-phenyl-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]-5,8-dihydro-1H-pyrrolo[3,4-g]isoquinolin-7-one.
| Compound Name | 3-(2-methyl-4-pyridinyl)-6-[(3S,4R)-4-phenyl-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]-5,8-dihydro-1H-pyrrolo[3,4-g]isoquinolin-7-one |
|---|---|
| PubChem CID | 147121604 |
| Molecular Formula | C30H29F3N4O |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 3-(2-methyl-4-pyridinyl)-6-[(3S,4R)-4-phenyl-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]-5,8-dihydro-1H-pyrrolo[3,4-g]isoquinolin-7-one |
| SMILES | Cc1cc(C2=NCc3cc4c(cc32)CN([C@@H]2CN(CCC(F)(F)F)C[C@H]2c2ccccc2)C(=O)C4)ccn1 |
| InChI | InChI=1S/C30H29F3N4O/c1-19-11-21(7-9-34-19)29-25-13-24-16-37(28(38)14-22(24)12-23(25)15-35-29)27-18-36(10-8-30(31,32)33)17-26(27)20-5-3-2-4-6-20/h2-7,9,11-13,26-27H,8,10,14-18H2,1H3/t26-,27+/m0/s1 |
| InChIKey | BOLWUUVAAOWSIM-RRPNLBNLSA-N |
| XLogP | 5.05 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |