C17H16N2O3S — CID 1471309
2-(2-cyanophenyl)sulfonyl-N-propan-2-ylbenzamide (PubChem CID 1471309) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-(2-cyanophenyl)sulfonyl-N-propan-2-ylbenzamide.
| Compound Name | 2-(2-cyanophenyl)sulfonyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 1471309 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-(2-cyanophenyl)sulfonyl-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccccc1S(=O)(=O)c1ccccc1C#N |
| InChI | InChI=1S/C17H16N2O3S/c1-12(2)19-17(20)14-8-4-6-10-16(14)23(21,22)15-9-5-3-7-13(15)11-18/h3-10,12H,1-2H3,(H,19,20) |
| InChIKey | PTTYSZVJKNJBMM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |