C26H26Cl2N4O4 — CID 147139373
(E)-N-[2-[[6-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)acetyl]-methylamino]pyrimidin-4-yl]methyl]phenyl]but-2-enamide (PubChem CID 147139373) has the molecular formula C26H26Cl2N4O4 and a molecular weight of 529.42 g/mol. Its IUPAC name is (E)-N-[2-[[6-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)acetyl]-methylamino]pyrimidin-4-yl]methyl]phenyl]but-2-enamide.
| Compound Name | (E)-N-[2-[[6-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)acetyl]-methylamino]pyrimidin-4-yl]methyl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 147139373 |
| Molecular Formula | C26H26Cl2N4O4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | (E)-N-[2-[[6-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)acetyl]-methylamino]pyrimidin-4-yl]methyl]phenyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccccc1Cc1cc(N(C)C(=O)Cc2c(Cl)c(OC)cc(OC)c2Cl)ncn1 |
| InChI | InChI=1S/C26H26Cl2N4O4/c1-5-8-23(33)31-19-10-7-6-9-16(19)11-17-12-22(30-15-29-17)32(2)24(34)13-18-25(27)20(35-3)14-21(36-4)26(18)28/h5-10,12,14-15H,11,13H2,1-4H3,(H,31,33)/b8-5+ |
| InChIKey | BRUKMPUSZKEUNZ-VMPITWQZSA-N |
| XLogP | 5.11 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|