C22H20Cl2N4O5 — CID 159432526
2-(2,6-dichloro-3,5-dimethoxyphenyl)-N-methyl-N-[6-[(2-nitrophenyl)methyl]pyrimidin-4-yl]acetamide (PubChem CID 159432526) has the molecular formula C22H20Cl2N4O5 and a molecular weight of 491.33 g/mol. Its IUPAC name is 2-(2,6-dichloro-3,5-dimethoxyphenyl)-N-methyl-N-[6-[(2-nitrophenyl)methyl]pyrimidin-4-yl]acetamide.
| Compound Name | 2-(2,6-dichloro-3,5-dimethoxyphenyl)-N-methyl-N-[6-[(2-nitrophenyl)methyl]pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 159432526 |
| Molecular Formula | C22H20Cl2N4O5 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 2-(2,6-dichloro-3,5-dimethoxyphenyl)-N-methyl-N-[6-[(2-nitrophenyl)methyl]pyrimidin-4-yl]acetamide |
| SMILES | COc1cc(OC)c(Cl)c(CC(=O)N(C)c2cc(Cc3ccccc3[N+](=O)[O-])ncn2)c1Cl |
| InChI | InChI=1S/C22H20Cl2N4O5/c1-27(20(29)10-15-21(23)17(32-2)11-18(33-3)22(15)24)19-9-14(25-12-26-19)8-13-6-4-5-7-16(13)28(30)31/h4-7,9,11-12H,8,10H2,1-3H3 |
| InChIKey | HGUBIZGCJUIXFH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 107.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|