C14H22O3 — CID 14715045
1-butyl-2-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one (PubChem CID 14715045) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-butyl-2-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one.
| Compound Name | 1-butyl-2-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one |
|---|---|
| PubChem CID | 14715045 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 1-butyl-2-tert-butyl-5,8-dioxaspiro[3.4]oct-1-en-3-one |
| SMILES | CCCCC1=C(C(C)(C)C)C(=O)C12OCCO2 |
| InChI | InChI=1S/C14H22O3/c1-5-6-7-10-11(13(2,3)4)12(15)14(10)16-8-9-17-14/h5-9H2,1-4H3 |
| InChIKey | ZXJMOVFDSPZYKI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |