C11H16O3 — CID 11138034
1-butyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one (PubChem CID 11138034) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-butyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one.
| Compound Name | 1-butyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one |
|---|---|
| PubChem CID | 11138034 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1-butyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one |
| SMILES | CCCCC1=C(C)C(=O)C12OCCO2 |
| InChI | InChI=1S/C11H16O3/c1-3-4-5-9-8(2)10(12)11(9)13-6-7-14-11/h3-7H2,1-2H3 |
| InChIKey | ZRVFBSSBXOMLAA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |