About 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one
1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one (PubChem CID 14952261) has the molecular formula C9H10O4
and a molecular weight of 182.17 g/mol. Its IUPAC name is 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one.
Molecular Properties
| Compound Name | 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one |
| PubChem CID | 14952261 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one |
| SMILES | CC(=O)C1=C(C)C(=O)C12OCCO2 |
| InChI | InChI=1S/C9H10O4/c1-5-7(6(2)10)9(8(5)11)12-3-4-13-9/h3-4H2,1-2H3 |
| InChIKey | RCIMPWBPXGVWKV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one?
The IUPAC name of 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one (CID 14952261) is 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one.
What is the SMILES notation for 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one?
The canonical SMILES for 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one is CC(=O)C1=C(C)C(=O)C12OCCO2.
What is the InChIKey of 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one?
The InChIKey is RCIMPWBPXGVWKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c1-5-7(6(2)10)9(8(5)11)12-3-4-13-9/h3-4H2,1-2H3.
What are the key properties of 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one?
1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one has a molecular weight of 182.17 g/mol, XLogP of 0.22, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-2-methyl-5,8-dioxaspiro[3.4]oct-1-en-3-one is sourced from PubChem (CID 14952261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).