C11H14O2 — CID 14715251
(2E)-2-benzylidenebutane-1,4-diol (PubChem CID 14715251) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (2E)-2-benzylidenebutane-1,4-diol.
| Compound Name | (2E)-2-benzylidenebutane-1,4-diol |
|---|---|
| PubChem CID | 14715251 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2E)-2-benzylidenebutane-1,4-diol |
| SMILES | OCC/C(=C\c1ccccc1)CO |
| InChI | InChI=1S/C11H14O2/c12-7-6-11(9-13)8-10-4-2-1-3-5-10/h1-5,8,12-13H,6-7,9H2/b11-8+ |
| InChIKey | PPYYXQAOODXXRG-DHZHZOJOSA-N |
| XLogP | 1.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |