C10H11BF2O2SWY-2 — CID 147162533
[5-[2,2-difluoroethyl(methylidene)-λ4-sulfanyl]-2-methylbenzene-4-id-1-yl]boronic acid;tungsten;yttrium (PubChem CID 147162533) has the molecular formula C10H11BF2O2SWY-2 and a molecular weight of 516.82 g/mol. Its IUPAC name is [5-[2,2-difluoroethyl(methylidene)-λ4-sulfanyl]-2-methylbenzene-4-id-1-yl]boronic acid;tungsten;yttrium.
| Compound Name | [5-[2,2-difluoroethyl(methylidene)-λ4-sulfanyl]-2-methylbenzene-4-id-1-yl]boronic acid;tungsten;yttrium |
|---|---|
| PubChem CID | 147162533 |
| Molecular Formula | C10H11BF2O2SWY-2 |
| Molecular Weight | 516.82 g/mol |
| Exact Mass | 516.91 |
| IUPAC Name | [5-[2,2-difluoroethyl(methylidene)-λ4-sulfanyl]-2-methylbenzene-4-id-1-yl]boronic acid;tungsten;yttrium |
| SMILES | C=S(C[C-](F)F)c1[c-]cc(C)c(B(O)O)c1.[W].[Y] |
| InChI | InChI=1S/C10H11BF2O2S.W.Y/c1-7-3-4-8(5-9(7)11(14)15)16(2)6-10(12)13;;/h3,5,14-15H,2,6H2,1H3;;/q-2;; |
| InChIKey | UFWBMFJOAMXUFY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.82 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|