C11H12F2SWY-2 — CID 161008663
2,2-difluoroethyl-(3,4-dimethylbenzene-6-id-1-yl)-methylidene-λ4-sulfane;tungsten;yttrium (PubChem CID 161008663) has the molecular formula C11H12F2SWY-2 and a molecular weight of 487.03 g/mol. Its IUPAC name is 2,2-difluoroethyl-(3,4-dimethylbenzene-6-id-1-yl)-methylidene-λ4-sulfane;tungsten;yttrium.
| Compound Name | 2,2-difluoroethyl-(3,4-dimethylbenzene-6-id-1-yl)-methylidene-λ4-sulfane;tungsten;yttrium |
|---|---|
| PubChem CID | 161008663 |
| Molecular Formula | C11H12F2SWY-2 |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 486.92 |
| IUPAC Name | 2,2-difluoroethyl-(3,4-dimethylbenzene-6-id-1-yl)-methylidene-λ4-sulfane;tungsten;yttrium |
| SMILES | C=S(C[C-](F)F)c1[c-]cc(C)c(C)c1.[W].[Y] |
| InChI | InChI=1S/C11H12F2S.W.Y/c1-8-4-5-10(6-9(8)2)14(3)7-11(12)13;;/h4,6H,3,7H2,1-2H3;;/q-2;; |
| InChIKey | GDZIJYCPXLKGPZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|