C22H31NO3 — CID 147162870
(10R,13S,17S)-10,13-dimethyl-17-(methylcarbamoyl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid (PubChem CID 147162870) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is (10R,13S,17S)-10,13-dimethyl-17-(methylcarbamoyl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid.
| Compound Name | (10R,13S,17S)-10,13-dimethyl-17-(methylcarbamoyl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 147162870 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (10R,13S,17S)-10,13-dimethyl-17-(methylcarbamoyl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid |
| SMILES | CNC(=O)[C@H]1CCC2C3CC=C4C=C(C(=O)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C22H31NO3/c1-21-10-8-13(20(25)26)12-14(21)4-5-15-16-6-7-18(19(24)23-3)22(16,2)11-9-17(15)21/h4,12,15-18H,5-11H2,1-3H3,(H,23,24)(H,25,26)/t15?,16?,17?,18-,21+,22+/m1/s1 |
| InChIKey | BWEISUBJKFUIQL-MDSSOGGJSA-N |
| XLogP | 3.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |