C23H30F3NO3 — CID 67744640
(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2,2,2-trifluoroethylcarbamoyl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid (PubChem CID 67744640) has the molecular formula C23H30F3NO3 and a molecular weight of 425.49 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2,2,2-trifluoroethylcarbamoyl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid.
| Compound Name | (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2,2,2-trifluoroethylcarbamoyl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 67744640 |
| Molecular Formula | C23H30F3NO3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2,2,2-trifluoroethylcarbamoyl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C=C(C(=O)O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C23H30F3NO3/c1-21-9-7-13(20(29)30)11-14(21)3-4-15-16-5-6-18(19(28)27-12-23(24,25)26)22(16,2)10-8-17(15)21/h3,11,15-18H,4-10,12H2,1-2H3,(H,27,28)(H,29,30)/t15-,16-,17-,18+,21-,22-/m0/s1 |
| InChIKey | GYUUOLAZTDZULZ-VABCKDIBSA-N |
| XLogP | 4.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |