C25H20ClF3N4O3 — CID 147169915
(3R)-1-[5-chloro-6-(5-hydroxypent-1-ynyl)pyrimidin-4-yl]-3-[3-[5-(trifluoromethyl)-3H-indol-2-yl]-1,2-oxazol-5-yl]butan-1-one (PubChem CID 147169915) has the molecular formula C25H20ClF3N4O3 and a molecular weight of 516.91 g/mol. Its IUPAC name is (3R)-1-[5-chloro-6-(5-hydroxypent-1-ynyl)pyrimidin-4-yl]-3-[3-[5-(trifluoromethyl)-3H-indol-2-yl]-1,2-oxazol-5-yl]butan-1-one.
| Compound Name | (3R)-1-[5-chloro-6-(5-hydroxypent-1-ynyl)pyrimidin-4-yl]-3-[3-[5-(trifluoromethyl)-3H-indol-2-yl]-1,2-oxazol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 147169915 |
| Molecular Formula | C25H20ClF3N4O3 |
| Molecular Weight | 516.91 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | (3R)-1-[5-chloro-6-(5-hydroxypent-1-ynyl)pyrimidin-4-yl]-3-[3-[5-(trifluoromethyl)-3H-indol-2-yl]-1,2-oxazol-5-yl]butan-1-one |
| SMILES | C[C@H](CC(=O)c1ncnc(C#CCCCO)c1Cl)c1cc(C2=Nc3ccc(C(F)(F)F)cc3C2)no1 |
| InChI | InChI=1S/C25H20ClF3N4O3/c1-14(9-21(35)24-23(26)18(30-13-31-24)5-3-2-4-8-34)22-12-20(33-36-22)19-11-15-10-16(25(27,28)29)6-7-17(15)32-19/h6-7,10,12-14,34H,2,4,8-9,11H2,1H3/t14-/m1/s1 |
| InChIKey | BXNFGIHAOJJYMV-CQSZACIVSA-N |
| XLogP | 5.31 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.91 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|