C25H37BrFN3OSi — CID 147171809
[(3S,5R)-1-[3-[2-(6-bromo-5-fluoro-2-pyridinyl)ethyl]-4-pyridinyl]-3,5-dimethylpiperidin-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 147171809) has the molecular formula C25H37BrFN3OSi and a molecular weight of 522.58 g/mol. Its IUPAC name is [(3S,5R)-1-[3-[2-(6-bromo-5-fluoro-2-pyridinyl)ethyl]-4-pyridinyl]-3,5-dimethylpiperidin-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,5R)-1-[3-[2-(6-bromo-5-fluoro-2-pyridinyl)ethyl]-4-pyridinyl]-3,5-dimethylpiperidin-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 147171809 |
| Molecular Formula | C25H37BrFN3OSi |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | [(3S,5R)-1-[3-[2-(6-bromo-5-fluoro-2-pyridinyl)ethyl]-4-pyridinyl]-3,5-dimethylpiperidin-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H]1CN(c2ccncc2CCc2ccc(F)c(Br)n2)C[C@H](C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H37BrFN3OSi/c1-17-15-30(16-18(2)23(17)31-32(6,7)25(3,4)5)22-12-13-28-14-19(22)8-9-20-10-11-21(27)24(26)29-20/h10-14,17-18,23H,8-9,15-16H2,1-7H3/t17-,18+,23? |
| InChIKey | BXWAXPWUJARCFN-NHJWOMDBSA-N |
| XLogP | 6.65 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|