About 1-cyclohexyl-2,4-dimethylcyclohexane
1-cyclohexyl-2,4-dimethylcyclohexane (PubChem CID 147177054) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is 1-cyclohexyl-2,4-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-cyclohexyl-2,4-dimethylcyclohexane |
| PubChem CID | 147177054 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 1-cyclohexyl-2,4-dimethylcyclohexane |
| SMILES | CC1CCC(C2CCCCC2)C(C)C1 |
| InChI | InChI=1S/C14H26/c1-11-8-9-14(12(2)10-11)13-6-4-3-5-7-13/h11-14H,3-10H2,1-2H3 |
| InChIKey | ILUVXSHPYDEAPE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclohexyl-2,4-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2,4-dimethylcyclohexane?
The IUPAC name of 1-cyclohexyl-2,4-dimethylcyclohexane (CID 147177054) is 1-cyclohexyl-2,4-dimethylcyclohexane.
What is the SMILES notation for 1-cyclohexyl-2,4-dimethylcyclohexane?
The canonical SMILES for 1-cyclohexyl-2,4-dimethylcyclohexane is CC1CCC(C2CCCCC2)C(C)C1.
What is the InChIKey of 1-cyclohexyl-2,4-dimethylcyclohexane?
The InChIKey is ILUVXSHPYDEAPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26/c1-11-8-9-14(12(2)10-11)13-6-4-3-5-7-13/h11-14H,3-10H2,1-2H3.
What are the key properties of 1-cyclohexyl-2,4-dimethylcyclohexane?
1-cyclohexyl-2,4-dimethylcyclohexane has a molecular weight of 194.36 g/mol, XLogP of 4.64, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2,4-dimethylcyclohexane is sourced from PubChem (CID 147177054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).