About cyclohexylcyclohexane
cyclohexylcyclohexane (PubChem CID 7094) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is cyclohexylcyclohexane.
Molecular Properties
| Compound Name | cyclohexylcyclohexane |
| PubChem CID | 7094 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | cyclohexylcyclohexane |
| SMILES | C1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C12H22/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h11-12H,1-10H2 |
| InChIKey | WVIIMZNLDWSIRH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclohexylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylcyclohexane?
The IUPAC name of cyclohexylcyclohexane (CID 7094) is cyclohexylcyclohexane.
What is the SMILES notation for cyclohexylcyclohexane?
The canonical SMILES for cyclohexylcyclohexane is C1CCC(C2CCCCC2)CC1.
What is the InChIKey of cyclohexylcyclohexane?
The InChIKey is WVIIMZNLDWSIRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h11-12H,1-10H2.
What are the key properties of cyclohexylcyclohexane?
cyclohexylcyclohexane has a molecular weight of 166.31 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylcyclohexane is sourced from PubChem (CID 7094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).