C16H28O6 — CID 14718699
diethyl 2-cyclopropyl-2-(2,2-diethoxyethyl)propanedioate (PubChem CID 14718699) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is diethyl 2-cyclopropyl-2-(2,2-diethoxyethyl)propanedioate.
| Compound Name | diethyl 2-cyclopropyl-2-(2,2-diethoxyethyl)propanedioate |
|---|---|
| PubChem CID | 14718699 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | diethyl 2-cyclopropyl-2-(2,2-diethoxyethyl)propanedioate |
| SMILES | CCOC(=O)C(CC(OCC)OCC)(C(=O)OCC)C1CC1 |
| InChI | InChI=1S/C16H28O6/c1-5-19-13(20-6-2)11-16(12-9-10-12,14(17)21-7-3)15(18)22-8-4/h12-13H,5-11H2,1-4H3 |
| InChIKey | VJHUWUPRUKHKTD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|