C16H26N2O2 — CID 14718703
ethyl 2-(2-tert-butylpyrimidin-5-yl)-3,3-dimethylbutanoate (PubChem CID 14718703) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is ethyl 2-(2-tert-butylpyrimidin-5-yl)-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-(2-tert-butylpyrimidin-5-yl)-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 14718703 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | ethyl 2-(2-tert-butylpyrimidin-5-yl)-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(c1cnc(C(C)(C)C)nc1)C(C)(C)C |
| InChI | InChI=1S/C16H26N2O2/c1-8-20-13(19)12(15(2,3)4)11-9-17-14(18-10-11)16(5,6)7/h9-10,12H,8H2,1-7H3 |
| InChIKey | KCHWLIZCVASREG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |