C32H43F2N3O5 — CID 14720124
benzyl N-[5-[[2-(benzylcarbamoyl)-3-methylbutanoyl]amino]-1-cyclohexyl-4,4-difluoro-3-hydroxypentan-2-yl]carbamate (PubChem CID 14720124) has the molecular formula C32H43F2N3O5 and a molecular weight of 587.71 g/mol. Its IUPAC name is benzyl N-[5-[[2-(benzylcarbamoyl)-3-methylbutanoyl]amino]-1-cyclohexyl-4,4-difluoro-3-hydroxypentan-2-yl]carbamate.
| Compound Name | benzyl N-[5-[[2-(benzylcarbamoyl)-3-methylbutanoyl]amino]-1-cyclohexyl-4,4-difluoro-3-hydroxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 14720124 |
| Molecular Formula | C32H43F2N3O5 |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.32 |
| IUPAC Name | benzyl N-[5-[[2-(benzylcarbamoyl)-3-methylbutanoyl]amino]-1-cyclohexyl-4,4-difluoro-3-hydroxypentan-2-yl]carbamate |
| SMILES | CC(C)C(C(=O)NCc1ccccc1)C(=O)NCC(F)(F)C(O)C(CC1CCCCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H43F2N3O5/c1-22(2)27(29(39)35-19-24-14-8-4-9-15-24)30(40)36-21-32(33,34)28(38)26(18-23-12-6-3-7-13-23)37-31(41)42-20-25-16-10-5-11-17-25/h4-5,8-11,14-17,22-23,26-28,38H,3,6-7,12-13,18-21H2,1-2H3,(H,35,39)(H,36,40)(H,37,41) |
| InChIKey | PQBMZKONXYWBHH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|