C24H26Cl2N2O4S2 — CID 147205242
5-chloro-N-[5-[(5-chloro-2-methoxybenzenecarbothioyl)-methylamino]-3-methyl-2,4-dioxopentyl]-2-methoxy-N-methylbenzenecarbothioamide (PubChem CID 147205242) has the molecular formula C24H26Cl2N2O4S2 and a molecular weight of 541.52 g/mol. Its IUPAC name is 5-chloro-N-[5-[(5-chloro-2-methoxybenzenecarbothioyl)-methylamino]-3-methyl-2,4-dioxopentyl]-2-methoxy-N-methylbenzenecarbothioamide.
| Compound Name | 5-chloro-N-[5-[(5-chloro-2-methoxybenzenecarbothioyl)-methylamino]-3-methyl-2,4-dioxopentyl]-2-methoxy-N-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 147205242 |
| Molecular Formula | C24H26Cl2N2O4S2 |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | 5-chloro-N-[5-[(5-chloro-2-methoxybenzenecarbothioyl)-methylamino]-3-methyl-2,4-dioxopentyl]-2-methoxy-N-methylbenzenecarbothioamide |
| SMILES | COc1ccc(Cl)cc1C(=S)N(C)CC(=O)C(C)C(=O)CN(C)C(=S)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C24H26Cl2N2O4S2/c1-14(19(29)12-27(2)23(33)17-10-15(25)6-8-21(17)31-4)20(30)13-28(3)24(34)18-11-16(26)7-9-22(18)32-5/h6-11,14H,12-13H2,1-5H3 |
| InChIKey | CEDFJCZJZGSFRT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|