C22H26N4O3 — CID 147205876
(2S)-1-(5-amino-3-oxohex-4-enoyl)-N-[[4-(1H-pyrrol-3-yl)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 147205876) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is (2S)-1-(5-amino-3-oxohex-4-enoyl)-N-[[4-(1H-pyrrol-3-yl)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(5-amino-3-oxohex-4-enoyl)-N-[[4-(1H-pyrrol-3-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 147205876 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (2S)-1-(5-amino-3-oxohex-4-enoyl)-N-[[4-(1H-pyrrol-3-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CC(N)=CC(=O)CC(=O)N1CCC[C@H]1C(=O)NCc1ccc(-c2cc[nH]c2)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-15(23)11-19(27)12-21(28)26-10-2-3-20(26)22(29)25-13-16-4-6-17(7-5-16)18-8-9-24-14-18/h4-9,11,14,20,24H,2-3,10,12-13,23H2,1H3,(H,25,29)/t20-/m0/s1 |
| InChIKey | MDTYKXVTMXHFFJ-FQEVSTJZSA-N |
| XLogP | 2.11 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|