C10H18N2O — CID 147212838
(3S)-3,6,6-trimethyl-2,3,7,8-tetrahydro-1H-pyrazolo[1,2-a]pyridazin-5-one (PubChem CID 147212838) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (3S)-3,6,6-trimethyl-2,3,7,8-tetrahydro-1H-pyrazolo[1,2-a]pyridazin-5-one.
| Compound Name | (3S)-3,6,6-trimethyl-2,3,7,8-tetrahydro-1H-pyrazolo[1,2-a]pyridazin-5-one |
|---|---|
| PubChem CID | 147212838 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (3S)-3,6,6-trimethyl-2,3,7,8-tetrahydro-1H-pyrazolo[1,2-a]pyridazin-5-one |
| SMILES | C[C@H]1CCN2CCC(C)(C)C(=O)N12 |
| InChI | InChI=1S/C10H18N2O/c1-8-4-6-11-7-5-10(2,3)9(13)12(8)11/h8H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | CFNOUTKMDHJUPS-QMMMGPOBSA-N |
| XLogP | 1.25 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |