C9H17N3 — CID 126641485
2,8-dimethyl-1-methylidene-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-a][1,2,4]triazine (PubChem CID 126641485) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 2,8-dimethyl-1-methylidene-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-a][1,2,4]triazine.
| Compound Name | 2,8-dimethyl-1-methylidene-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-a][1,2,4]triazine |
|---|---|
| PubChem CID | 126641485 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 2,8-dimethyl-1-methylidene-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-a][1,2,4]triazine |
| SMILES | C=C1N(C)CCN2CCC(C)N12 |
| InChI | InChI=1S/C9H17N3/c1-8-4-5-11-7-6-10(3)9(2)12(8)11/h8H,2,4-7H2,1,3H3 |
| InChIKey | HSOISMPIBAYWLN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |