C8H16N2 — CID 151869152
3-ethyl-1,4-dimethyl-2-methylideneimidazolidine (PubChem CID 151869152) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 3-ethyl-1,4-dimethyl-2-methylideneimidazolidine.
| Compound Name | 3-ethyl-1,4-dimethyl-2-methylideneimidazolidine |
|---|---|
| PubChem CID | 151869152 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 3-ethyl-1,4-dimethyl-2-methylideneimidazolidine |
| SMILES | C=C1N(C)CC(C)N1CC |
| InChI | InChI=1S/C8H16N2/c1-5-10-7(2)6-9(4)8(10)3/h7H,3,5-6H2,1-2,4H3 |
| InChIKey | SMHXLSYWEMZPAH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |