C10H20N2O — CID 139472829
(4R)-3-tert-butyl-1,4-dimethyl-1,3-diazinan-2-one (PubChem CID 139472829) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is (4R)-3-tert-butyl-1,4-dimethyl-1,3-diazinan-2-one.
| Compound Name | (4R)-3-tert-butyl-1,4-dimethyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 139472829 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (4R)-3-tert-butyl-1,4-dimethyl-1,3-diazinan-2-one |
| SMILES | C[C@@H]1CCN(C)C(=O)N1C(C)(C)C |
| InChI | InChI=1S/C10H20N2O/c1-8-6-7-11(5)9(13)12(8)10(2,3)4/h8H,6-7H2,1-5H3/t8-/m1/s1 |
| InChIKey | MAUUPUCBRMGZFD-MRVPVSSYSA-N |
| XLogP | 1.93 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |