C13H26N2O — CID 138627508
1,4-ditert-butyl-6-methylpiperazin-2-one (PubChem CID 138627508) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 1,4-ditert-butyl-6-methylpiperazin-2-one.
| Compound Name | 1,4-ditert-butyl-6-methylpiperazin-2-one |
|---|---|
| PubChem CID | 138627508 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 1,4-ditert-butyl-6-methylpiperazin-2-one |
| SMILES | CC1CN(C(C)(C)C)CC(=O)N1C(C)(C)C |
| InChI | InChI=1S/C13H26N2O/c1-10-8-14(12(2,3)4)9-11(16)15(10)13(5,6)7/h10H,8-9H2,1-7H3 |
| InChIKey | RIKCNWQJIWVERP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |