C21H40N4O — CID 163962747
5-tert-butyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2-tert-butyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 163962747) has the molecular formula C21H40N4O and a molecular weight of 364.58 g/mol. Its IUPAC name is 5-tert-butyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2-tert-butyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | 5-tert-butyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2-tert-butyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 163962747 |
| Molecular Formula | C21H40N4O |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.32 |
| IUPAC Name | 5-tert-butyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2-tert-butyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | CC(C)(C)N1CC(=O)N2CCCC2C1.CC(C)(C)N1CC2CNCC2C1 |
| InChI | InChI=1S/C11H20N2O.C10H20N2/c1-11(2,3)12-7-9-5-4-6-13(9)10(14)8-12;1-10(2,3)12-6-8-4-11-5-9(8)7-12/h9H,4-8H2,1-3H3;8-9,11H,4-7H2,1-3H3 |
| InChIKey | SIYWXJWEGPATPW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |