C13H23NO — CID 135039748
(9aS)-8-tert-butyl-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-5-one (PubChem CID 135039748) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (9aS)-8-tert-butyl-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-5-one.
| Compound Name | (9aS)-8-tert-butyl-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-5-one |
|---|---|
| PubChem CID | 135039748 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (9aS)-8-tert-butyl-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-5-one |
| SMILES | CC(C)(C)C1CCC(=O)N2CCC[C@H]2C1 |
| InChI | InChI=1S/C13H23NO/c1-13(2,3)10-6-7-12(15)14-8-4-5-11(14)9-10/h10-11H,4-9H2,1-3H3/t10?,11-/m0/s1 |
| InChIKey | XVGYMACAKAEDFP-DTIOYNMSSA-N |
| XLogP | 2.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |